About cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid
cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid (PubChem CID 174719402) has the molecular formula C11H11Cl2NO5S
and a molecular weight of 340.18 g/mol. Its IUPAC name is cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid.
Molecular Properties
| Compound Name | cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid |
| PubChem CID | 174719402 |
| Molecular Formula | C11H11Cl2NO5S |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid |
| SMILES | O=C(OC1CCC1)N(c1cccc(Cl)c1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C11H11Cl2NO5S/c12-8-5-2-6-9(10(8)13)14(20(16,17)18)11(15)19-7-3-1-4-7/h2,5-7H,1,3-4H2,(H,16,17,18) |
| InChIKey | QTBSSOSHQOXEMV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid?
The IUPAC name of cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid (CID 174719402) is cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid.
What is the SMILES notation for cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid?
The canonical SMILES for cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid is O=C(OC1CCC1)N(c1cccc(Cl)c1Cl)S(=O)(=O)O.
What is the InChIKey of cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid?
The InChIKey is QTBSSOSHQOXEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2NO5S/c12-8-5-2-6-9(10(8)13)14(20(16,17)18)11(15)19-7-3-1-4-7/h2,5-7H,1,3-4H2,(H,16,17,18).
What are the key properties of cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid?
cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid has a molecular weight of 340.18 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyloxycarbonyl-(2,3-dichlorophenyl)sulfamic acid is sourced from PubChem (CID 174719402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).