C35H32Cl2F6Zr — CID 174719542
3,6-ditert-butyl-2,7-bis[4-(trifluoromethyl)phenyl]-9H-fluorene;dichlorozirconium (PubChem CID 174719542) has the molecular formula C35H32Cl2F6Zr and a molecular weight of 728.76 g/mol. Its IUPAC name is 3,6-ditert-butyl-2,7-bis[4-(trifluoromethyl)phenyl]-9H-fluorene;dichlorozirconium.
| Compound Name | 3,6-ditert-butyl-2,7-bis[4-(trifluoromethyl)phenyl]-9H-fluorene;dichlorozirconium |
|---|---|
| PubChem CID | 174719542 |
| Molecular Formula | C35H32Cl2F6Zr |
| Molecular Weight | 728.76 g/mol |
| Exact Mass | 726.08 |
| IUPAC Name | 3,6-ditert-butyl-2,7-bis[4-(trifluoromethyl)phenyl]-9H-fluorene;dichlorozirconium |
| SMILES | CC(C)(C)c1cc2c(cc1-c1ccc(C(F)(F)F)cc1)Cc1cc(-c3ccc(C(F)(F)F)cc3)c(C(C)(C)C)cc1-2.Cl[Zr]Cl |
| InChI | InChI=1S/C35H32F6.2ClH.Zr/c1-32(2,3)30-18-26-22(16-28(30)20-7-11-24(12-8-20)34(36,37)38)15-23-17-29(31(19-27(23)26)33(4,5)6)21-9-13-25(14-10-21)35(39,40)41;;;/h7-14,16-19H,15H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FKCRUULHBVBIMJ-UHFFFAOYSA-L |
| XLogP | 12.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.76 |
| LogP ≤ 5 | 12.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |