C9H18N2O2S — CID 174720397
2-prop-2-enylsulfonylcyclohexane-1,1-diamine (PubChem CID 174720397) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-prop-2-enylsulfonylcyclohexane-1,1-diamine.
| Compound Name | 2-prop-2-enylsulfonylcyclohexane-1,1-diamine |
|---|---|
| PubChem CID | 174720397 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-prop-2-enylsulfonylcyclohexane-1,1-diamine |
| SMILES | C=CCS(=O)(=O)C1CCCCC1(N)N |
| InChI | InChI=1S/C9H18N2O2S/c1-2-7-14(12,13)8-5-3-4-6-9(8,10)11/h2,8H,1,3-7,10-11H2 |
| InChIKey | YMWZRSSTBAVUSN-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|