(2,4-difluorophenoxy)sulfonylmethanesulfonic acid

C7H6F2O6S2 — CID 174720523

IUPAC(2,4-difluorophenoxy)sulfonylmethanesulfonic acid
SMILESO=S(=O)(O)CS(=O)(=O)Oc1ccc(F)cc1F
InChIInChI=1S/C7H6F2O6S2/c8-5-1-2-7(6(9)3-5)15-17(13,14)4-16(10,11)12/h1-3H,4H2,(H,10,11,12)
InChIKeyBSCVBRCHNARQTL-UHFFFAOYSA-N
MW288.25 g/mol
LogP0.52
Rot. Bonds4

About (2,4-difluorophenoxy)sulfonylmethanesulfonic acid

(2,4-difluorophenoxy)sulfonylmethanesulfonic acid (PubChem CID 174720523) has the molecular formula C7H6F2O6S2 and a molecular weight of 288.25 g/mol. Its IUPAC name is (2,4-difluorophenoxy)sulfonylmethanesulfonic acid.

Molecular Properties

Compound Name(2,4-difluorophenoxy)sulfonylmethanesulfonic acid
PubChem CID174720523
Molecular FormulaC7H6F2O6S2
Molecular Weight288.25 g/mol
Exact Mass287.96
IUPAC Name(2,4-difluorophenoxy)sulfonylmethanesulfonic acid
SMILESO=S(=O)(O)CS(=O)(=O)Oc1ccc(F)cc1F
InChIInChI=1S/C7H6F2O6S2/c8-5-1-2-7(6(9)3-5)15-17(13,14)4-16(10,11)12/h1-3H,4H2,(H,10,11,12)
InChIKeyBSCVBRCHNARQTL-UHFFFAOYSA-N
XLogP0.52
TPSA97.74 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.25
LogP ≤ 50.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze (2,4-difluorophenoxy)sulfonylmethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-difluorophenoxy)sulfonylmethanesulfonic acid?
The IUPAC name of (2,4-difluorophenoxy)sulfonylmethanesulfonic acid (CID 174720523) is (2,4-difluorophenoxy)sulfonylmethanesulfonic acid.
What is the SMILES notation for (2,4-difluorophenoxy)sulfonylmethanesulfonic acid?
The canonical SMILES for (2,4-difluorophenoxy)sulfonylmethanesulfonic acid is O=S(=O)(O)CS(=O)(=O)Oc1ccc(F)cc1F.
What is the InChIKey of (2,4-difluorophenoxy)sulfonylmethanesulfonic acid?
The InChIKey is BSCVBRCHNARQTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F2O6S2/c8-5-1-2-7(6(9)3-5)15-17(13,14)4-16(10,11)12/h1-3H,4H2,(H,10,11,12).
What are the key properties of (2,4-difluorophenoxy)sulfonylmethanesulfonic acid?
(2,4-difluorophenoxy)sulfonylmethanesulfonic acid has a molecular weight of 288.25 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-difluorophenoxy)sulfonylmethanesulfonic acid is sourced from PubChem (CID 174720523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).