About nitrous acid;2-phosphanyloxybenzoic acid
nitrous acid;2-phosphanyloxybenzoic acid (PubChem CID 174720888) has the molecular formula C7H8NO5P
and a molecular weight of 217.12 g/mol. Its IUPAC name is nitrous acid;2-phosphanyloxybenzoic acid.
Molecular Properties
| Compound Name | nitrous acid;2-phosphanyloxybenzoic acid |
| PubChem CID | 174720888 |
| Molecular Formula | C7H8NO5P |
| Molecular Weight | 217.12 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | nitrous acid;2-phosphanyloxybenzoic acid |
| SMILES | O=C(O)c1ccccc1OP.O=NO |
| InChI | InChI=1S/C7H7O3P.HNO2/c8-7(9)5-3-1-2-4-6(5)10-11;2-1-3/h1-4H,11H2,(H,8,9);(H,2,3) |
| InChIKey | OMTACZJNRFKEKM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.12 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nitrous acid;2-phosphanyloxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrous acid;2-phosphanyloxybenzoic acid?
The IUPAC name of nitrous acid;2-phosphanyloxybenzoic acid (CID 174720888) is nitrous acid;2-phosphanyloxybenzoic acid.
What is the SMILES notation for nitrous acid;2-phosphanyloxybenzoic acid?
The canonical SMILES for nitrous acid;2-phosphanyloxybenzoic acid is O=C(O)c1ccccc1OP.O=NO.
What is the InChIKey of nitrous acid;2-phosphanyloxybenzoic acid?
The InChIKey is OMTACZJNRFKEKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7O3P.HNO2/c8-7(9)5-3-1-2-4-6(5)10-11;2-1-3/h1-4H,11H2,(H,8,9);(H,2,3).
What are the key properties of nitrous acid;2-phosphanyloxybenzoic acid?
nitrous acid;2-phosphanyloxybenzoic acid has a molecular weight of 217.12 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrous acid;2-phosphanyloxybenzoic acid is sourced from PubChem (CID 174720888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).