About 2-(1,2-dihydropyridin-4-yl)porphyrin
2-(1,2-dihydropyridin-4-yl)porphyrin (PubChem CID 174720907) has the molecular formula C25H17N5
and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-(1,2-dihydropyridin-4-yl)porphyrin.
Molecular Properties
| Compound Name | 2-(1,2-dihydropyridin-4-yl)porphyrin |
| PubChem CID | 174720907 |
| Molecular Formula | C25H17N5 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 2-(1,2-dihydropyridin-4-yl)porphyrin |
| SMILES | C1=CC(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)=CCN1 |
| InChI | InChI=1S/C25H17N5/c1-2-18-12-20-5-6-22(29-20)15-25-24(16-7-9-26-10-8-16)14-23(30-25)13-21-4-3-19(28-21)11-17(1)27-18/h1-9,11-15,26H,10H2/b17-11-,18-12-,19-11-,20-12-,21-13-,22-15-,23-13-,25-15- |
| InChIKey | OHPAEEUFYMXAFI-OGPHAVTISA-N |
| XLogP | 3.99 |
| TPSA | 61.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,2-dihydropyridin-4-yl)porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-dihydropyridin-4-yl)porphyrin?
The IUPAC name of 2-(1,2-dihydropyridin-4-yl)porphyrin (CID 174720907) is 2-(1,2-dihydropyridin-4-yl)porphyrin.
What is the SMILES notation for 2-(1,2-dihydropyridin-4-yl)porphyrin?
The canonical SMILES for 2-(1,2-dihydropyridin-4-yl)porphyrin is C1=CC(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)=CCN1.
What is the InChIKey of 2-(1,2-dihydropyridin-4-yl)porphyrin?
The InChIKey is OHPAEEUFYMXAFI-OGPHAVTISA-N. The full InChI is InChI=1S/C25H17N5/c1-2-18-12-20-5-6-22(29-20)15-25-24(16-7-9-26-10-8-16)14-23(30-25)13-21-4-3-19(28-21)11-17(1)27-18/h1-9,11-15,26H,10H2/b17-11-,18-12-,19-11-,20-12-,21-13-,22-15-,23-13-,25-15-.
What are the key properties of 2-(1,2-dihydropyridin-4-yl)porphyrin?
2-(1,2-dihydropyridin-4-yl)porphyrin has a molecular weight of 387.45 g/mol, XLogP of 3.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-dihydropyridin-4-yl)porphyrin is sourced from PubChem (CID 174720907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).