About 1,3-oxazole;1,10-phenanthroline;pyrazine
1,3-oxazole;1,10-phenanthroline;pyrazine (PubChem CID 174721121) has the molecular formula C19H15N5O
and a molecular weight of 329.36 g/mol. Its IUPAC name is 1,3-oxazole;1,10-phenanthroline;pyrazine.
Molecular Properties
| Compound Name | 1,3-oxazole;1,10-phenanthroline;pyrazine |
| PubChem CID | 174721121 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 1,3-oxazole;1,10-phenanthroline;pyrazine |
| SMILES | c1cnc2c(c1)ccc1cccnc12.c1cnccn1.c1cocn1 |
| InChI | InChI=1S/C12H8N2.C4H4N2.C3H3NO/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-2-6-4-3-5-1;1-2-5-3-4-1/h1-8H;1-4H;1-3H |
| InChIKey | NLWRRBQUYQPKDP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxazole;1,10-phenanthroline;pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazole;1,10-phenanthroline;pyrazine?
The IUPAC name of 1,3-oxazole;1,10-phenanthroline;pyrazine (CID 174721121) is 1,3-oxazole;1,10-phenanthroline;pyrazine.
What is the SMILES notation for 1,3-oxazole;1,10-phenanthroline;pyrazine?
The canonical SMILES for 1,3-oxazole;1,10-phenanthroline;pyrazine is c1cnc2c(c1)ccc1cccnc12.c1cnccn1.c1cocn1.
What is the InChIKey of 1,3-oxazole;1,10-phenanthroline;pyrazine?
The InChIKey is NLWRRBQUYQPKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C4H4N2.C3H3NO/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-2-6-4-3-5-1;1-2-5-3-4-1/h1-8H;1-4H;1-3H.
What are the key properties of 1,3-oxazole;1,10-phenanthroline;pyrazine?
1,3-oxazole;1,10-phenanthroline;pyrazine has a molecular weight of 329.36 g/mol, XLogP of 3.93, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazole;1,10-phenanthroline;pyrazine is sourced from PubChem (CID 174721121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).