About 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one
1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one (PubChem CID 174721431) has the molecular formula C8H12ClNOS
and a molecular weight of 205.71 g/mol. Its IUPAC name is 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one.
Molecular Properties
| Compound Name | 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one |
| PubChem CID | 174721431 |
| Molecular Formula | C8H12ClNOS |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.03 |
| IUPAC Name | 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one |
| SMILES | CC1(C)SC=CN1CC(=O)CCl |
| InChI | InChI=1S/C8H12ClNOS/c1-8(2)10(3-4-12-8)6-7(11)5-9/h3-4H,5-6H2,1-2H3 |
| InChIKey | WZYBVPQLTJXXDL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one?
The IUPAC name of 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one (CID 174721431) is 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one.
What is the SMILES notation for 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one?
The canonical SMILES for 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one is CC1(C)SC=CN1CC(=O)CCl.
What is the InChIKey of 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one?
The InChIKey is WZYBVPQLTJXXDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNOS/c1-8(2)10(3-4-12-8)6-7(11)5-9/h3-4H,5-6H2,1-2H3.
What are the key properties of 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one?
1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one has a molecular weight of 205.71 g/mol, XLogP of 2.05, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(2,2-dimethyl-1,3-thiazol-3-yl)propan-2-one is sourced from PubChem (CID 174721431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).