About 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate
1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate (PubChem CID 174722147) has the molecular formula C6H7N5OS
and a molecular weight of 197.22 g/mol. Its IUPAC name is 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate.
Molecular Properties
| Compound Name | 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate |
| PubChem CID | 174722147 |
| Molecular Formula | C6H7N5OS |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate |
| SMILES | [H]/N=C(\C#N)OC(C)c1nsc(N)n1 |
| InChI | InChI=1S/C6H7N5OS/c1-3(12-4(8)2-7)5-10-6(9)13-11-5/h3,8H,1H3,(H2,9,10,11)/b8-4+ |
| InChIKey | YNZBXMAPHYUXIU-XBXARRHUSA-N |
| XLogP | 0.70 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate?
The IUPAC name of 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate (CID 174722147) is 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate.
What is the SMILES notation for 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate?
The canonical SMILES for 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate is [H]/N=C(\C#N)OC(C)c1nsc(N)n1.
What is the InChIKey of 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate?
The InChIKey is YNZBXMAPHYUXIU-XBXARRHUSA-N. The full InChI is InChI=1S/C6H7N5OS/c1-3(12-4(8)2-7)5-10-6(9)13-11-5/h3,8H,1H3,(H2,9,10,11)/b8-4+.
What are the key properties of 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate?
1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate has a molecular weight of 197.22 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,2,4-thiadiazol-3-yl)ethyl cyanomethanimidate is sourced from PubChem (CID 174722147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).