About 2-(4-amino-3,5-dimethylphenyl)ethanethioamide
2-(4-amino-3,5-dimethylphenyl)ethanethioamide (PubChem CID 174722251) has the molecular formula C10H14N2S
and a molecular weight of 194.30 g/mol. Its IUPAC name is 2-(4-amino-3,5-dimethylphenyl)ethanethioamide.
Molecular Properties
| Compound Name | 2-(4-amino-3,5-dimethylphenyl)ethanethioamide |
| PubChem CID | 174722251 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-(4-amino-3,5-dimethylphenyl)ethanethioamide |
| SMILES | Cc1cc(CC(N)=S)cc(C)c1N |
| InChI | InChI=1S/C10H14N2S/c1-6-3-8(5-9(11)13)4-7(2)10(6)12/h3-4H,5,12H2,1-2H3,(H2,11,13) |
| InChIKey | YHZCXAJOSIPZQW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-amino-3,5-dimethylphenyl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-amino-3,5-dimethylphenyl)ethanethioamide?
The IUPAC name of 2-(4-amino-3,5-dimethylphenyl)ethanethioamide (CID 174722251) is 2-(4-amino-3,5-dimethylphenyl)ethanethioamide.
What is the SMILES notation for 2-(4-amino-3,5-dimethylphenyl)ethanethioamide?
The canonical SMILES for 2-(4-amino-3,5-dimethylphenyl)ethanethioamide is Cc1cc(CC(N)=S)cc(C)c1N.
What is the InChIKey of 2-(4-amino-3,5-dimethylphenyl)ethanethioamide?
The InChIKey is YHZCXAJOSIPZQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S/c1-6-3-8(5-9(11)13)4-7(2)10(6)12/h3-4H,5,12H2,1-2H3,(H2,11,13).
What are the key properties of 2-(4-amino-3,5-dimethylphenyl)ethanethioamide?
2-(4-amino-3,5-dimethylphenyl)ethanethioamide has a molecular weight of 194.30 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-amino-3,5-dimethylphenyl)ethanethioamide is sourced from PubChem (CID 174722251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).