C9H8N4O — CID 174723125
1,5-naphthyridine-4-carbohydrazide (PubChem CID 174723125) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 1,5-naphthyridine-4-carbohydrazide.
| Compound Name | 1,5-naphthyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 174723125 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 1,5-naphthyridine-4-carbohydrazide |
| SMILES | NNC(=O)c1ccnc2cccnc12 |
| InChI | InChI=1S/C9H8N4O/c10-13-9(14)6-3-5-11-7-2-1-4-12-8(6)7/h1-5H,10H2,(H,13,14) |
| InChIKey | HARXWLXTQIDPDW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|