About 2-imino-1-methylimidazolidin-4-one;2-methylguanidine
2-imino-1-methylimidazolidin-4-one;2-methylguanidine (PubChem CID 174723899) has the molecular formula C6H14N6O
and a molecular weight of 186.22 g/mol. Its IUPAC name is 2-imino-1-methylimidazolidin-4-one;2-methylguanidine.
Molecular Properties
| Compound Name | 2-imino-1-methylimidazolidin-4-one;2-methylguanidine |
| PubChem CID | 174723899 |
| Molecular Formula | C6H14N6O |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 2-imino-1-methylimidazolidin-4-one;2-methylguanidine |
| SMILES | CN=C(N)N.[H]/N=C1/NC(=O)CN1C |
| InChI | InChI=1S/C4H7N3O.C2H7N3/c1-7-2-3(8)6-4(7)5;1-5-2(3)4/h2H2,1H3,(H2,5,6,8);1H3,(H4,3,4,5) |
| InChIKey | FVTIXIKGOWGQJO-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-1-methylimidazolidin-4-one;2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-1-methylimidazolidin-4-one;2-methylguanidine?
The IUPAC name of 2-imino-1-methylimidazolidin-4-one;2-methylguanidine (CID 174723899) is 2-imino-1-methylimidazolidin-4-one;2-methylguanidine.
What is the SMILES notation for 2-imino-1-methylimidazolidin-4-one;2-methylguanidine?
The canonical SMILES for 2-imino-1-methylimidazolidin-4-one;2-methylguanidine is CN=C(N)N.[H]/N=C1/NC(=O)CN1C.
What is the InChIKey of 2-imino-1-methylimidazolidin-4-one;2-methylguanidine?
The InChIKey is FVTIXIKGOWGQJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O.C2H7N3/c1-7-2-3(8)6-4(7)5;1-5-2(3)4/h2H2,1H3,(H2,5,6,8);1H3,(H4,3,4,5).
What are the key properties of 2-imino-1-methylimidazolidin-4-one;2-methylguanidine?
2-imino-1-methylimidazolidin-4-one;2-methylguanidine has a molecular weight of 186.22 g/mol, XLogP of -2.13, 0 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-1-methylimidazolidin-4-one;2-methylguanidine is sourced from PubChem (CID 174723899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).