About 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal
2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal (PubChem CID 174724435) has the molecular formula C6H6O6
and a molecular weight of 174.11 g/mol. Its IUPAC name is 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal.
Molecular Properties
| Compound Name | 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal |
| PubChem CID | 174724435 |
| Molecular Formula | C6H6O6 |
| Molecular Weight | 174.11 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal |
| SMILES | O=CC(=O)C(=O)C1OCOCO1 |
| InChI | InChI=1S/C6H6O6/c7-1-4(8)5(9)6-11-2-10-3-12-6/h1,6H,2-3H2 |
| InChIKey | OUCJUTHDISNJCD-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.11 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal?
The IUPAC name of 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal (CID 174724435) is 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal.
What is the SMILES notation for 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal?
The canonical SMILES for 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal is O=CC(=O)C(=O)C1OCOCO1.
What is the InChIKey of 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal?
The InChIKey is OUCJUTHDISNJCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O6/c7-1-4(8)5(9)6-11-2-10-3-12-6/h1,6H,2-3H2.
What are the key properties of 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal?
2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal has a molecular weight of 174.11 g/mol, XLogP of -1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dioxo-3-(1,3,5-trioxan-2-yl)propanal is sourced from PubChem (CID 174724435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).