About (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate
(5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate (PubChem CID 174724919) has the molecular formula C16H15BrClNO2
and a molecular weight of 368.66 g/mol. Its IUPAC name is (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate.
Molecular Properties
| Compound Name | (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate |
| PubChem CID | 174724919 |
| Molecular Formula | C16H15BrClNO2 |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate |
| SMILES | CC(C(=O)Oc1cncc(Br)c1)C(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15BrClNO2/c1-10(12-3-5-14(18)6-4-12)11(2)16(20)21-15-7-13(17)8-19-9-15/h3-11H,1-2H3 |
| InChIKey | SNBZWKSVFQRPGK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate?
The IUPAC name of (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate (CID 174724919) is (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate.
What is the SMILES notation for (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate?
The canonical SMILES for (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate is CC(C(=O)Oc1cncc(Br)c1)C(C)c1ccc(Cl)cc1.
What is the InChIKey of (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate?
The InChIKey is SNBZWKSVFQRPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrClNO2/c1-10(12-3-5-14(18)6-4-12)11(2)16(20)21-15-7-13(17)8-19-9-15/h3-11H,1-2H3.
What are the key properties of (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate?
(5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate has a molecular weight of 368.66 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-3-pyridinyl) 3-(4-chlorophenyl)-2-methylbutanoate is sourced from PubChem (CID 174724919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).