C18H24F3NO4 — CID 174725073
tert-butyl formate;piperidin-4-yl-[2-(trifluoromethoxy)phenyl]methanone (PubChem CID 174725073) has the molecular formula C18H24F3NO4 and a molecular weight of 375.39 g/mol. Its IUPAC name is tert-butyl formate;piperidin-4-yl-[2-(trifluoromethoxy)phenyl]methanone.
| Compound Name | tert-butyl formate;piperidin-4-yl-[2-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 174725073 |
| Molecular Formula | C18H24F3NO4 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl formate;piperidin-4-yl-[2-(trifluoromethoxy)phenyl]methanone |
| SMILES | CC(C)(C)OC=O.O=C(c1ccccc1OC(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C13H14F3NO2.C5H10O2/c14-13(15,16)19-11-4-2-1-3-10(11)12(18)9-5-7-17-8-6-9;1-5(2,3)7-4-6/h1-4,9,17H,5-8H2;4H,1-3H3 |
| InChIKey | JWGXKPNPPJOCQN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|