About isoindole-1,3-dione;oxadiazole
isoindole-1,3-dione;oxadiazole (PubChem CID 174725577) has the molecular formula C10H7N3O3
and a molecular weight of 217.18 g/mol. Its IUPAC name is isoindole-1,3-dione;oxadiazole.
Molecular Properties
| Compound Name | isoindole-1,3-dione;oxadiazole |
| PubChem CID | 174725577 |
| Molecular Formula | C10H7N3O3 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | isoindole-1,3-dione;oxadiazole |
| SMILES | O=C1NC(=O)c2ccccc21.c1conn1 |
| InChI | InChI=1S/C8H5NO2.C2H2N2O/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-5-4-3-1/h1-4H,(H,9,10,11);1-2H |
| InChIKey | RLZILQVEEIDOLD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindole-1,3-dione;oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindole-1,3-dione;oxadiazole?
The IUPAC name of isoindole-1,3-dione;oxadiazole (CID 174725577) is isoindole-1,3-dione;oxadiazole.
What is the SMILES notation for isoindole-1,3-dione;oxadiazole?
The canonical SMILES for isoindole-1,3-dione;oxadiazole is O=C1NC(=O)c2ccccc21.c1conn1.
What is the InChIKey of isoindole-1,3-dione;oxadiazole?
The InChIKey is RLZILQVEEIDOLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.C2H2N2O/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-5-4-3-1/h1-4H,(H,9,10,11);1-2H.
What are the key properties of isoindole-1,3-dione;oxadiazole?
isoindole-1,3-dione;oxadiazole has a molecular weight of 217.18 g/mol, XLogP of 0.64, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isoindole-1,3-dione;oxadiazole is sourced from PubChem (CID 174725577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).