C21H28N2O4 — CID 17472604
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]propanamide (PubChem CID 17472604) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 17472604 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-methyl-N-[[5-(2-methylcyclopropyl)furan-2-yl]methyl]propanamide |
| SMILES | CC1CC1c1ccc(CN(C)C(=O)CCN2C(=O)C3CCCCC3C2=O)o1 |
| InChI | InChI=1S/C21H28N2O4/c1-13-11-17(13)18-8-7-14(27-18)12-22(2)19(24)9-10-23-20(25)15-5-3-4-6-16(15)21(23)26/h7-8,13,15-17H,3-6,9-12H2,1-2H3 |
| InChIKey | CRSABPCRCATHRB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|