About hexanoyl 2-iodoheptanoate
hexanoyl 2-iodoheptanoate (PubChem CID 174726046) has the molecular formula C13H23IO3
and a molecular weight of 354.23 g/mol. Its IUPAC name is hexanoyl 2-iodoheptanoate.
Molecular Properties
| Compound Name | hexanoyl 2-iodoheptanoate |
| PubChem CID | 174726046 |
| Molecular Formula | C13H23IO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | hexanoyl 2-iodoheptanoate |
| SMILES | CCCCCC(=O)OC(=O)C(I)CCCCC |
| InChI | InChI=1S/C13H23IO3/c1-3-5-7-9-11(14)13(16)17-12(15)10-8-6-4-2/h11H,3-10H2,1-2H3 |
| InChIKey | BAGJCYDBDWGMBO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze hexanoyl 2-iodoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoyl 2-iodoheptanoate?
The IUPAC name of hexanoyl 2-iodoheptanoate (CID 174726046) is hexanoyl 2-iodoheptanoate.
What is the SMILES notation for hexanoyl 2-iodoheptanoate?
The canonical SMILES for hexanoyl 2-iodoheptanoate is CCCCCC(=O)OC(=O)C(I)CCCCC.
What is the InChIKey of hexanoyl 2-iodoheptanoate?
The InChIKey is BAGJCYDBDWGMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23IO3/c1-3-5-7-9-11(14)13(16)17-12(15)10-8-6-4-2/h11H,3-10H2,1-2H3.
What are the key properties of hexanoyl 2-iodoheptanoate?
hexanoyl 2-iodoheptanoate has a molecular weight of 354.23 g/mol, XLogP of 4.02, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoyl 2-iodoheptanoate is sourced from PubChem (CID 174726046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).