About azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride
azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride (PubChem CID 174727138) has the molecular formula C7H8Cl3N
and a molecular weight of 212.51 g/mol. Its IUPAC name is azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride.
Molecular Properties
| Compound Name | azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride |
| PubChem CID | 174727138 |
| Molecular Formula | C7H8Cl3N |
| Molecular Weight | 212.51 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride |
| SMILES | Cl.ClC1(Cl)c2cccc1c2.N |
| InChI | InChI=1S/C7H4Cl2.ClH.H3N/c8-7(9)5-2-1-3-6(7)4-5;;/h1-4H;1H;1H3 |
| InChIKey | DMORJDLJNDWMAA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride?
The IUPAC name of azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride (CID 174727138) is azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride.
What is the SMILES notation for azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride?
The canonical SMILES for azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride is Cl.ClC1(Cl)c2cccc1c2.N.
What is the InChIKey of azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride?
The InChIKey is DMORJDLJNDWMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2.ClH.H3N/c8-7(9)5-2-1-3-6(7)4-5;;/h1-4H;1H;1H3.
What are the key properties of azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride?
azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride has a molecular weight of 212.51 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;7,7-dichlorobicyclo[3.1.1]hepta-1(6),2,4-triene;hydrochloride is sourced from PubChem (CID 174727138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).