C20H30N2O3 — CID 174728422
4-(1-benzoylpyrrolidin-3-yl)butyl N-tert-butylcarbamate (PubChem CID 174728422) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 4-(1-benzoylpyrrolidin-3-yl)butyl N-tert-butylcarbamate.
| Compound Name | 4-(1-benzoylpyrrolidin-3-yl)butyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174728422 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 4-(1-benzoylpyrrolidin-3-yl)butyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCCC1CCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-20(2,3)21-19(24)25-14-8-7-9-16-12-13-22(15-16)18(23)17-10-5-4-6-11-17/h4-6,10-11,16H,7-9,12-15H2,1-3H3,(H,21,24) |
| InChIKey | IXSDMRKUZBPPEV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|