About acridine;1,2-dihydroquinoline
acridine;1,2-dihydroquinoline (PubChem CID 174729818) has the molecular formula C22H18N2
and a molecular weight of 310.40 g/mol. Its IUPAC name is acridine;1,2-dihydroquinoline.
Molecular Properties
| Compound Name | acridine;1,2-dihydroquinoline |
| PubChem CID | 174729818 |
| Molecular Formula | C22H18N2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | acridine;1,2-dihydroquinoline |
| SMILES | C1=Cc2ccccc2NC1.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N.C9H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-6-9-8(4-1)5-3-7-10-9/h1-9H;1-6,10H,7H2 |
| InChIKey | XXEXNSHRYANEMB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;1,2-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;1,2-dihydroquinoline?
The IUPAC name of acridine;1,2-dihydroquinoline (CID 174729818) is acridine;1,2-dihydroquinoline.
What is the SMILES notation for acridine;1,2-dihydroquinoline?
The canonical SMILES for acridine;1,2-dihydroquinoline is C1=Cc2ccccc2NC1.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;1,2-dihydroquinoline?
The InChIKey is XXEXNSHRYANEMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N.C9H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12;1-2-6-9-8(4-1)5-3-7-10-9/h1-9H;1-6,10H,7H2.
What are the key properties of acridine;1,2-dihydroquinoline?
acridine;1,2-dihydroquinoline has a molecular weight of 310.40 g/mol, XLogP of 5.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;1,2-dihydroquinoline is sourced from PubChem (CID 174729818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).