About acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine
acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 174729995) has the molecular formula C13H18F3N3O
and a molecular weight of 289.30 g/mol. Its IUPAC name is acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine |
| PubChem CID | 174729995 |
| Molecular Formula | C13H18F3N3O |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | CC#N.CCCCOc1nc(C(F)(F)F)ccc1NC |
| InChI | InChI=1S/C11H15F3N2O.C2H3N/c1-3-4-7-17-10-8(15-2)5-6-9(16-10)11(12,13)14;1-2-3/h5-6,15H,3-4,7H2,1-2H3;1H3 |
| InChIKey | TZAWUWBPKFNRPK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine?
The IUPAC name of acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine (CID 174729995) is acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine.
What is the SMILES notation for acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine?
The canonical SMILES for acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine is CC#N.CCCCOc1nc(C(F)(F)F)ccc1NC.
What is the InChIKey of acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine?
The InChIKey is TZAWUWBPKFNRPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F3N2O.C2H3N/c1-3-4-7-17-10-8(15-2)5-6-9(16-10)11(12,13)14;1-2-3/h5-6,15H,3-4,7H2,1-2H3;1H3.
What are the key properties of acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine?
acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine has a molecular weight of 289.30 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-butoxy-N-methyl-6-(trifluoromethyl)pyridin-3-amine is sourced from PubChem (CID 174729995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).