C26H30BrN3O4 — CID 174730843
2-[1-(2-bromobenzoyl)piperidin-4-yl]-5-(3,4-dimethoxyphenyl)-4,4-dimethyl-3H-pyrazole-3-carbaldehyde (PubChem CID 174730843) has the molecular formula C26H30BrN3O4 and a molecular weight of 528.45 g/mol. Its IUPAC name is 2-[1-(2-bromobenzoyl)piperidin-4-yl]-5-(3,4-dimethoxyphenyl)-4,4-dimethyl-3H-pyrazole-3-carbaldehyde.
| Compound Name | 2-[1-(2-bromobenzoyl)piperidin-4-yl]-5-(3,4-dimethoxyphenyl)-4,4-dimethyl-3H-pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 174730843 |
| Molecular Formula | C26H30BrN3O4 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 2-[1-(2-bromobenzoyl)piperidin-4-yl]-5-(3,4-dimethoxyphenyl)-4,4-dimethyl-3H-pyrazole-3-carbaldehyde |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)c4ccccc4Br)CC3)C(C=O)C2(C)C)cc1OC |
| InChI | InChI=1S/C26H30BrN3O4/c1-26(2)23(16-31)30(28-24(26)17-9-10-21(33-3)22(15-17)34-4)18-11-13-29(14-12-18)25(32)19-7-5-6-8-20(19)27/h5-10,15-16,18,23H,11-14H2,1-4H3 |
| InChIKey | ICWZFDRLZPSCOG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|