C23H23N5O4 — CID 174731230
3-[[3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-2,4-dioxo-5-prop-2-enylimidazolidin-1-yl]methyl]benzaldehyde (PubChem CID 174731230) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 3-[[3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-2,4-dioxo-5-prop-2-enylimidazolidin-1-yl]methyl]benzaldehyde.
| Compound Name | 3-[[3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-2,4-dioxo-5-prop-2-enylimidazolidin-1-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 174731230 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 3-[[3-[1-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]pyrazol-4-yl]-2,4-dioxo-5-prop-2-enylimidazolidin-1-yl]methyl]benzaldehyde |
| SMILES | C=CCC1C(=O)N(c2cnn(Cc3c(C)noc3C)c2)C(=O)N1Cc1cccc(C=O)c1 |
| InChI | InChI=1S/C23H23N5O4/c1-4-6-21-22(30)28(23(31)27(21)11-17-7-5-8-18(9-17)14-29)19-10-24-26(12-19)13-20-15(2)25-32-16(20)3/h4-5,7-10,12,14,21H,1,6,11,13H2,2-3H3 |
| InChIKey | YTAZYSIYDVNJFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 101.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|