C28H24N2 — CID 174732037
1,2-bis(4-methylphenyl)phenanthrene-9,10-diamine (PubChem CID 174732037) has the molecular formula C28H24N2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 1,2-bis(4-methylphenyl)phenanthrene-9,10-diamine.
| Compound Name | 1,2-bis(4-methylphenyl)phenanthrene-9,10-diamine |
|---|---|
| PubChem CID | 174732037 |
| Molecular Formula | C28H24N2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1,2-bis(4-methylphenyl)phenanthrene-9,10-diamine |
| SMILES | Cc1ccc(-c2ccc3c(c(N)c(N)c4ccccc43)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C28H24N2/c1-17-7-11-19(12-8-17)21-15-16-23-22-5-3-4-6-24(22)27(29)28(30)26(23)25(21)20-13-9-18(2)10-14-20/h3-16H,29-30H2,1-2H3 |
| InChIKey | UHJKUTOFULLKCQ-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|