About N-cyclohexylcyclohexanamine;2-methylmorpholine
N-cyclohexylcyclohexanamine;2-methylmorpholine (PubChem CID 174732220) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is N-cyclohexylcyclohexanamine;2-methylmorpholine.
Molecular Properties
| Compound Name | N-cyclohexylcyclohexanamine;2-methylmorpholine |
| PubChem CID | 174732220 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | N-cyclohexylcyclohexanamine;2-methylmorpholine |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC1CNCCO1 |
| InChI | InChI=1S/C12H23N.C5H11NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-4-6-2-3-7-5/h11-13H,1-10H2;5-6H,2-4H2,1H3 |
| InChIKey | WOINYFIDRRCQJM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexylcyclohexanamine;2-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcyclohexanamine;2-methylmorpholine?
The IUPAC name of N-cyclohexylcyclohexanamine;2-methylmorpholine (CID 174732220) is N-cyclohexylcyclohexanamine;2-methylmorpholine.
What is the SMILES notation for N-cyclohexylcyclohexanamine;2-methylmorpholine?
The canonical SMILES for N-cyclohexylcyclohexanamine;2-methylmorpholine is C1CCC(NC2CCCCC2)CC1.CC1CNCCO1.
What is the InChIKey of N-cyclohexylcyclohexanamine;2-methylmorpholine?
The InChIKey is WOINYFIDRRCQJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N.C5H11NO/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-4-6-2-3-7-5/h11-13H,1-10H2;5-6H,2-4H2,1H3.
What are the key properties of N-cyclohexylcyclohexanamine;2-methylmorpholine?
N-cyclohexylcyclohexanamine;2-methylmorpholine has a molecular weight of 282.47 g/mol, XLogP of 3.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcyclohexanamine;2-methylmorpholine is sourced from PubChem (CID 174732220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).