C27H23Cl2F3N2O4 — CID 174732509
benzyl formate;3-[4-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol (PubChem CID 174732509) has the molecular formula C27H23Cl2F3N2O4 and a molecular weight of 567.39 g/mol. Its IUPAC name is benzyl formate;3-[4-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol.
| Compound Name | benzyl formate;3-[4-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
|---|---|
| PubChem CID | 174732509 |
| Molecular Formula | C27H23Cl2F3N2O4 |
| Molecular Weight | 567.39 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | benzyl formate;3-[4-[(5S)-5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]phenyl]azetidin-3-ol |
| SMILES | O=COCc1ccccc1.OC1(c2ccc(C3=NO[C@@](c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)cc2)CNC1 |
| InChI | InChI=1S/C19H15Cl2F3N2O2.C8H8O2/c20-14-5-13(6-15(21)7-14)18(19(22,23)24)8-16(26-28-18)11-1-3-12(4-2-11)17(27)9-25-10-17;9-7-10-6-8-4-2-1-3-5-8/h1-7,25,27H,8-10H2;1-5,7H,6H2/t18-;/m0./s1 |
| InChIKey | ARXDOFYYDHDZRX-FERBBOLQSA-N |
| XLogP | 5.73 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.39 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|