About chlorophosphane;N,N-dimethylmethanamine
chlorophosphane;N,N-dimethylmethanamine (PubChem CID 174732579) has the molecular formula C3H11ClNP
and a molecular weight of 127.56 g/mol. Its IUPAC name is chlorophosphane;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | chlorophosphane;N,N-dimethylmethanamine |
| PubChem CID | 174732579 |
| Molecular Formula | C3H11ClNP |
| Molecular Weight | 127.56 g/mol |
| Exact Mass | 127.03 |
| IUPAC Name | chlorophosphane;N,N-dimethylmethanamine |
| SMILES | CN(C)C.PCl |
| InChI | InChI=1S/C3H9N.ClH2P/c1-4(2)3;1-2/h1-3H3;2H2 |
| InChIKey | TWVRERUZEVOVTK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.56 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorophosphane;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorophosphane;N,N-dimethylmethanamine?
The IUPAC name of chlorophosphane;N,N-dimethylmethanamine (CID 174732579) is chlorophosphane;N,N-dimethylmethanamine.
What is the SMILES notation for chlorophosphane;N,N-dimethylmethanamine?
The canonical SMILES for chlorophosphane;N,N-dimethylmethanamine is CN(C)C.PCl.
What is the InChIKey of chlorophosphane;N,N-dimethylmethanamine?
The InChIKey is TWVRERUZEVOVTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.ClH2P/c1-4(2)3;1-2/h1-3H3;2H2.
What are the key properties of chlorophosphane;N,N-dimethylmethanamine?
chlorophosphane;N,N-dimethylmethanamine has a molecular weight of 127.56 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chlorophosphane;N,N-dimethylmethanamine is sourced from PubChem (CID 174732579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).