About hydron;2-(2H-tetrazol-5-yl)acetic acid
hydron;2-(2H-tetrazol-5-yl)acetic acid (PubChem CID 174732621) has the molecular formula C3H5N4O2+
and a molecular weight of 129.10 g/mol. Its IUPAC name is hydron;2-(2H-tetrazol-5-yl)acetic acid.
Molecular Properties
| Compound Name | hydron;2-(2H-tetrazol-5-yl)acetic acid |
| PubChem CID | 174732621 |
| Molecular Formula | C3H5N4O2+ |
| Molecular Weight | 129.10 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | hydron;2-(2H-tetrazol-5-yl)acetic acid |
| SMILES | O=C(O)Cc1nn[nH]n1.[H+] |
| InChI | InChI=1S/C3H4N4O2/c8-3(9)1-2-4-6-7-5-2/h1H2,(H,8,9)(H,4,5,6,7)/p+1 |
| InChIKey | JUNAPQMUUHSYOV-UHFFFAOYSA-O |
| XLogP | -1.06 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.10 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze hydron;2-(2H-tetrazol-5-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-(2H-tetrazol-5-yl)acetic acid?
The IUPAC name of hydron;2-(2H-tetrazol-5-yl)acetic acid (CID 174732621) is hydron;2-(2H-tetrazol-5-yl)acetic acid.
What is the SMILES notation for hydron;2-(2H-tetrazol-5-yl)acetic acid?
The canonical SMILES for hydron;2-(2H-tetrazol-5-yl)acetic acid is O=C(O)Cc1nn[nH]n1.[H+].
What is the InChIKey of hydron;2-(2H-tetrazol-5-yl)acetic acid?
The InChIKey is JUNAPQMUUHSYOV-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H4N4O2/c8-3(9)1-2-4-6-7-5-2/h1H2,(H,8,9)(H,4,5,6,7)/p+1.
What are the key properties of hydron;2-(2H-tetrazol-5-yl)acetic acid?
hydron;2-(2H-tetrazol-5-yl)acetic acid has a molecular weight of 129.10 g/mol, XLogP of -1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-(2H-tetrazol-5-yl)acetic acid is sourced from PubChem (CID 174732621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).