About 2,2-dimethyl-1,4-dioxane;ethene
2,2-dimethyl-1,4-dioxane;ethene (PubChem CID 174732671) has the molecular formula C8H16O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 2,2-dimethyl-1,4-dioxane;ethene.
Molecular Properties
| Compound Name | 2,2-dimethyl-1,4-dioxane;ethene |
| PubChem CID | 174732671 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | 2,2-dimethyl-1,4-dioxane;ethene |
| SMILES | C=C.CC1(C)COCCO1 |
| InChI | InChI=1S/C6H12O2.C2H4/c1-6(2)5-7-3-4-8-6;1-2/h3-5H2,1-2H3;1-2H2 |
| InChIKey | YJNHSAZICVOIPZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-1,4-dioxane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1,4-dioxane;ethene?
The IUPAC name of 2,2-dimethyl-1,4-dioxane;ethene (CID 174732671) is 2,2-dimethyl-1,4-dioxane;ethene.
What is the SMILES notation for 2,2-dimethyl-1,4-dioxane;ethene?
The canonical SMILES for 2,2-dimethyl-1,4-dioxane;ethene is C=C.CC1(C)COCCO1.
What is the InChIKey of 2,2-dimethyl-1,4-dioxane;ethene?
The InChIKey is YJNHSAZICVOIPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C2H4/c1-6(2)5-7-3-4-8-6;1-2/h3-5H2,1-2H3;1-2H2.
What are the key properties of 2,2-dimethyl-1,4-dioxane;ethene?
2,2-dimethyl-1,4-dioxane;ethene has a molecular weight of 144.21 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1,4-dioxane;ethene is sourced from PubChem (CID 174732671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).