C8H18N2O4S — CID 174732778
methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole (PubChem CID 174732778) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole.
| Compound Name | methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole |
|---|---|
| PubChem CID | 174732778 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole |
| SMILES | CC1=C(C)N(C)CN1C.COS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2.CH4O4S/c1-6-7(2)9(4)5-8(6)3;1-5-6(2,3)4/h5H2,1-4H3;1H3,(H,2,3,4) |
| InChIKey | YKTJPURQCRESSF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|