methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole

C8H18N2O4S — CID 174732778

IUPACmethyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole
SMILESCC1=C(C)N(C)CN1C.COS(=O)(=O)O
InChIInChI=1S/C7H14N2.CH4O4S/c1-6-7(2)9(4)5-8(6)3;1-5-6(2,3)4/h5H2,1-4H3;1H3,(H,2,3,4)
InChIKeyYKTJPURQCRESSF-UHFFFAOYSA-N
MW238.31 g/mol
LogP0.51
Rot. Bonds1

About methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole

methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole (PubChem CID 174732778) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole.

Molecular Properties

Compound Namemethyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole
PubChem CID174732778
Molecular FormulaC8H18N2O4S
Molecular Weight238.31 g/mol
Exact Mass238.10
IUPAC Namemethyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole
SMILESCC1=C(C)N(C)CN1C.COS(=O)(=O)O
InChIInChI=1S/C7H14N2.CH4O4S/c1-6-7(2)9(4)5-8(6)3;1-5-6(2,3)4/h5H2,1-4H3;1H3,(H,2,3,4)
InChIKeyYKTJPURQCRESSF-UHFFFAOYSA-N
XLogP0.51
TPSA70.08 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.31
LogP ≤ 50.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole?
The IUPAC name of methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole (CID 174732778) is methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole.
What is the SMILES notation for methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole?
The canonical SMILES for methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole is CC1=C(C)N(C)CN1C.COS(=O)(=O)O.
What is the InChIKey of methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole?
The InChIKey is YKTJPURQCRESSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.CH4O4S/c1-6-7(2)9(4)5-8(6)3;1-5-6(2,3)4/h5H2,1-4H3;1H3,(H,2,3,4).
What are the key properties of methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole?
methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole has a molecular weight of 238.31 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen sulfate;1,3,4,5-tetramethyl-2H-imidazole is sourced from PubChem (CID 174732778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).