C20H23NO4S — CID 174732959
methyl 2-(3-benzylsulfanylpropanoylamino)-3-(4-hydroxyphenyl)propanoate (PubChem CID 174732959) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is methyl 2-(3-benzylsulfanylpropanoylamino)-3-(4-hydroxyphenyl)propanoate.
| Compound Name | methyl 2-(3-benzylsulfanylpropanoylamino)-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 174732959 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 2-(3-benzylsulfanylpropanoylamino)-3-(4-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)CCSCc1ccccc1 |
| InChI | InChI=1S/C20H23NO4S/c1-25-20(24)18(13-15-7-9-17(22)10-8-15)21-19(23)11-12-26-14-16-5-3-2-4-6-16/h2-10,18,22H,11-14H2,1H3,(H,21,23) |
| InChIKey | TURCVFSKRYADID-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|