About N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride
N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride (PubChem CID 174733111) has the molecular formula C8H19ClN2O
and a molecular weight of 194.71 g/mol. Its IUPAC name is N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride |
| PubChem CID | 174733111 |
| Molecular Formula | C8H19ClN2O |
| Molecular Weight | 194.71 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride |
| SMILES | C=CC(=O)NC.CCN(C)C.Cl |
| InChI | InChI=1S/C4H7NO.C4H11N.ClH/c1-3-4(6)5-2;1-4-5(2)3;/h3H,1H2,2H3,(H,5,6);4H2,1-3H3;1H |
| InChIKey | NBJNRQTXQQGEPQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride?
The IUPAC name of N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride (CID 174733111) is N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride.
What is the SMILES notation for N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride?
The canonical SMILES for N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride is C=CC(=O)NC.CCN(C)C.Cl.
What is the InChIKey of N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride?
The InChIKey is NBJNRQTXQQGEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C4H11N.ClH/c1-3-4(6)5-2;1-4-5(2)3;/h3H,1H2,2H3,(H,5,6);4H2,1-3H3;1H.
What are the key properties of N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride?
N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride has a molecular weight of 194.71 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylethanamine;N-methylprop-2-enamide;hydrochloride is sourced from PubChem (CID 174733111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).