About 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine
4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine (PubChem CID 174733230) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine.
Molecular Properties
| Compound Name | 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine |
| PubChem CID | 174733230 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine |
| SMILES | COc1cc(C#Cc2ccn(CC3CCNCC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-23-18-11-16(12-19(13-18)24-2)3-4-17-7-10-22(21-17)14-15-5-8-20-9-6-15/h7,10-13,15,20H,5-6,8-9,14H2,1-2H3 |
| InChIKey | UIHYXVOOQNQESG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine?
The IUPAC name of 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine (CID 174733230) is 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine.
What is the SMILES notation for 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine?
The canonical SMILES for 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine is COc1cc(C#Cc2ccn(CC3CCNCC3)n2)cc(OC)c1.
What is the InChIKey of 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine?
The InChIKey is UIHYXVOOQNQESG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-23-18-11-16(12-19(13-18)24-2)3-4-17-7-10-22(21-17)14-15-5-8-20-9-6-15/h7,10-13,15,20H,5-6,8-9,14H2,1-2H3.
What are the key properties of 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine?
4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine has a molecular weight of 325.41 g/mol, XLogP of 2.30, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[3-[2-(3,5-dimethoxyphenyl)ethynyl]pyrazol-1-yl]methyl]piperidine is sourced from PubChem (CID 174733230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).