About azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid
azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid (PubChem CID 174733310) has the molecular formula C6H12NO9P
and a molecular weight of 273.13 g/mol. Its IUPAC name is azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid.
Molecular Properties
| Compound Name | azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid |
| PubChem CID | 174733310 |
| Molecular Formula | C6H12NO9P |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid |
| SMILES | N.O=C(O)COP(=O)(CC(=O)O)OCC(=O)O |
| InChI | InChI=1S/C6H9O9P.H3N/c7-4(8)1-14-16(13,3-6(11)12)15-2-5(9)10;/h1-3H2,(H,7,8)(H,9,10)(H,11,12);1H3 |
| InChIKey | ATSSECRCOQVQNS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 182.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The IUPAC name of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid (CID 174733310) is azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid.
What is the SMILES notation for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The canonical SMILES for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid is N.O=C(O)COP(=O)(CC(=O)O)OCC(=O)O.
What is the InChIKey of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The InChIKey is ATSSECRCOQVQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O9P.H3N/c7-4(8)1-14-16(13,3-6(11)12)15-2-5(9)10;/h1-3H2,(H,7,8)(H,9,10)(H,11,12);1H3.
What are the key properties of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid has a molecular weight of 273.13 g/mol, XLogP of -0.37, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid is sourced from PubChem (CID 174733310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).