azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid

C6H12NO9P — CID 174733310

IUPACazane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid
SMILESN.O=C(O)COP(=O)(CC(=O)O)OCC(=O)O
InChIInChI=1S/C6H9O9P.H3N/c7-4(8)1-14-16(13,3-6(11)12)15-2-5(9)10;/h1-3H2,(H,7,8)(H,9,10)(H,11,12);1H3
InChIKeyATSSECRCOQVQNS-UHFFFAOYSA-N
MW273.13 g/mol
LogP-0.37
Rot. Bonds8

About azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid

azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid (PubChem CID 174733310) has the molecular formula C6H12NO9P and a molecular weight of 273.13 g/mol. Its IUPAC name is azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid.

Molecular Properties

Compound Nameazane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid
PubChem CID174733310
Molecular FormulaC6H12NO9P
Molecular Weight273.13 g/mol
Exact Mass273.02
IUPAC Nameazane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid
SMILESN.O=C(O)COP(=O)(CC(=O)O)OCC(=O)O
InChIInChI=1S/C6H9O9P.H3N/c7-4(8)1-14-16(13,3-6(11)12)15-2-5(9)10;/h1-3H2,(H,7,8)(H,9,10)(H,11,12);1H3
InChIKeyATSSECRCOQVQNS-UHFFFAOYSA-N
XLogP-0.37
TPSA182.43 Ų
H-Bond Donors4
H-Bond Acceptors7
Rotatable Bonds8
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.13
LogP ≤ 5-0.37
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The IUPAC name of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid (CID 174733310) is azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid.
What is the SMILES notation for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The canonical SMILES for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid is N.O=C(O)COP(=O)(CC(=O)O)OCC(=O)O.
What is the InChIKey of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
The InChIKey is ATSSECRCOQVQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O9P.H3N/c7-4(8)1-14-16(13,3-6(11)12)15-2-5(9)10;/h1-3H2,(H,7,8)(H,9,10)(H,11,12);1H3.
What are the key properties of azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid?
azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid has a molecular weight of 273.13 g/mol, XLogP of -0.37, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-[carboxymethoxy(carboxymethyl)phosphoryl]oxyacetic acid is sourced from PubChem (CID 174733310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).