C9H6Cl2FNO2 — CID 174733379
2,2-dichloro-7-fluoro-3,4-dihydro-1,4-benzoxazine-3-carbaldehyde (PubChem CID 174733379) has the molecular formula C9H6Cl2FNO2 and a molecular weight of 250.06 g/mol. Its IUPAC name is 2,2-dichloro-7-fluoro-3,4-dihydro-1,4-benzoxazine-3-carbaldehyde.
| Compound Name | 2,2-dichloro-7-fluoro-3,4-dihydro-1,4-benzoxazine-3-carbaldehyde |
|---|---|
| PubChem CID | 174733379 |
| Molecular Formula | C9H6Cl2FNO2 |
| Molecular Weight | 250.06 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 2,2-dichloro-7-fluoro-3,4-dihydro-1,4-benzoxazine-3-carbaldehyde |
| SMILES | O=CC1Nc2ccc(F)cc2OC1(Cl)Cl |
| InChI | InChI=1S/C9H6Cl2FNO2/c10-9(11)8(4-14)13-6-2-1-5(12)3-7(6)15-9/h1-4,8,13H |
| InChIKey | HNSISNOSVSLLTF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.06 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|