About piperidin-1-yl 2-methylbenzoate
piperidin-1-yl 2-methylbenzoate (PubChem CID 174733401) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is piperidin-1-yl 2-methylbenzoate.
Molecular Properties
| Compound Name | piperidin-1-yl 2-methylbenzoate |
| PubChem CID | 174733401 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | piperidin-1-yl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)ON1CCCCC1 |
| InChI | InChI=1S/C13H17NO2/c1-11-7-3-4-8-12(11)13(15)16-14-9-5-2-6-10-14/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | SKMPHBIUEJYGCX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-1-yl 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-yl 2-methylbenzoate?
The IUPAC name of piperidin-1-yl 2-methylbenzoate (CID 174733401) is piperidin-1-yl 2-methylbenzoate.
What is the SMILES notation for piperidin-1-yl 2-methylbenzoate?
The canonical SMILES for piperidin-1-yl 2-methylbenzoate is Cc1ccccc1C(=O)ON1CCCCC1.
What is the InChIKey of piperidin-1-yl 2-methylbenzoate?
The InChIKey is SKMPHBIUEJYGCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-11-7-3-4-8-12(11)13(15)16-14-9-5-2-6-10-14/h3-4,7-8H,2,5-6,9-10H2,1H3.
What are the key properties of piperidin-1-yl 2-methylbenzoate?
piperidin-1-yl 2-methylbenzoate has a molecular weight of 219.28 g/mol, XLogP of 2.55, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-yl 2-methylbenzoate is sourced from PubChem (CID 174733401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).