About 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane
1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane (PubChem CID 174734462) has the molecular formula C14H16O3
and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane.
Molecular Properties
| Compound Name | 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane |
| PubChem CID | 174734462 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane |
| SMILES | CC(=O)c1ccc(O)c2ccccc12.COC |
| InChI | InChI=1S/C12H10O2.C2H6O/c1-8(13)9-6-7-12(14)11-5-3-2-4-10(9)11;1-3-2/h2-7,14H,1H3;1-2H3 |
| InChIKey | KJXXFAVYPJQTNA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane?
The IUPAC name of 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane (CID 174734462) is 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane.
What is the SMILES notation for 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane?
The canonical SMILES for 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane is CC(=O)c1ccc(O)c2ccccc12.COC.
What is the InChIKey of 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane?
The InChIKey is KJXXFAVYPJQTNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.C2H6O/c1-8(13)9-6-7-12(14)11-5-3-2-4-10(9)11;1-3-2/h2-7,14H,1H3;1-2H3.
What are the key properties of 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane?
1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane has a molecular weight of 232.28 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxynaphthalen-1-yl)ethanone;methoxymethane is sourced from PubChem (CID 174734462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).