C20H23BrN2O3 — CID 17473474
2-bromo-5-methoxy-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]benzamide (PubChem CID 17473474) has the molecular formula C20H23BrN2O3 and a molecular weight of 419.32 g/mol. Its IUPAC name is 2-bromo-5-methoxy-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2-bromo-5-methoxy-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 17473474 |
| Molecular Formula | C20H23BrN2O3 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-bromo-5-methoxy-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(Br)c(C(=O)NCc2ccc(CN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C20H23BrN2O3/c1-25-17-6-7-19(21)18(12-17)20(24)22-13-15-2-4-16(5-3-15)14-23-8-10-26-11-9-23/h2-7,12H,8-11,13-14H2,1H3,(H,22,24) |
| InChIKey | JHNNLWUVDBJHQI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |