About 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate
2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate (PubChem CID 174734781) has the molecular formula C7H7F2NO2
and a molecular weight of 175.13 g/mol. Its IUPAC name is 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate.
Molecular Properties
| Compound Name | 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate |
| PubChem CID | 174734781 |
| Molecular Formula | C7H7F2NO2 |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate |
| SMILES | O=COCCc1cc(F)c(F)[nH]1 |
| InChI | InChI=1S/C7H7F2NO2/c8-6-3-5(10-7(6)9)1-2-12-4-11/h3-4,10H,1-2H2 |
| InChIKey | IRWSSECMUIFADO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate?
The IUPAC name of 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate (CID 174734781) is 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate.
What is the SMILES notation for 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate?
The canonical SMILES for 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate is O=COCCc1cc(F)c(F)[nH]1.
What is the InChIKey of 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate?
The InChIKey is IRWSSECMUIFADO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F2NO2/c8-6-3-5(10-7(6)9)1-2-12-4-11/h3-4,10H,1-2H2.
What are the key properties of 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate?
2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate has a molecular weight of 175.13 g/mol, XLogP of 1.01, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-difluoro-1H-pyrrol-2-yl)ethyl formate is sourced from PubChem (CID 174734781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).