C15H24N2 — CID 174735067
2-(5,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1H-imidazole (PubChem CID 174735067) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1H-imidazole.
| Compound Name | 2-(5,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1H-imidazole |
|---|---|
| PubChem CID | 174735067 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-(5,6-dimethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-1H-imidazole |
| SMILES | CC1CCC2C(c3ncc[nH]3)CCCC2C1C |
| InChI | InChI=1S/C15H24N2/c1-10-6-7-13-12(11(10)2)4-3-5-14(13)15-16-8-9-17-15/h8-14H,3-7H2,1-2H3,(H,16,17) |
| InChIKey | QPLNCCYNTGDYIN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |