About 1-N,2-N-dibenzylimidazole-1,2-diamine
1-N,2-N-dibenzylimidazole-1,2-diamine (PubChem CID 174735131) has the molecular formula C17H18N4
and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-N,2-N-dibenzylimidazole-1,2-diamine.
Molecular Properties
| Compound Name | 1-N,2-N-dibenzylimidazole-1,2-diamine |
| PubChem CID | 174735131 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1-N,2-N-dibenzylimidazole-1,2-diamine |
| SMILES | c1ccc(CNc2nccn2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N4/c1-3-7-15(8-4-1)13-19-17-18-11-12-21(17)20-14-16-9-5-2-6-10-16/h1-12,20H,13-14H2,(H,18,19) |
| InChIKey | CCEQTISRFQMBLB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-N,2-N-dibenzylimidazole-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-dibenzylimidazole-1,2-diamine?
The IUPAC name of 1-N,2-N-dibenzylimidazole-1,2-diamine (CID 174735131) is 1-N,2-N-dibenzylimidazole-1,2-diamine.
What is the SMILES notation for 1-N,2-N-dibenzylimidazole-1,2-diamine?
The canonical SMILES for 1-N,2-N-dibenzylimidazole-1,2-diamine is c1ccc(CNc2nccn2NCc2ccccc2)cc1.
What is the InChIKey of 1-N,2-N-dibenzylimidazole-1,2-diamine?
The InChIKey is CCEQTISRFQMBLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4/c1-3-7-15(8-4-1)13-19-17-18-11-12-21(17)20-14-16-9-5-2-6-10-16/h1-12,20H,13-14H2,(H,18,19).
What are the key properties of 1-N,2-N-dibenzylimidazole-1,2-diamine?
1-N,2-N-dibenzylimidazole-1,2-diamine has a molecular weight of 278.36 g/mol, XLogP of 3.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-dibenzylimidazole-1,2-diamine is sourced from PubChem (CID 174735131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).