C25H23N — CID 174735552
(1S,2S)-2-benzyl-1,2,11,12-tetrahydrochrysen-1-amine (PubChem CID 174735552) has the molecular formula C25H23N and a molecular weight of 337.47 g/mol. Its IUPAC name is (1S,2S)-2-benzyl-1,2,11,12-tetrahydrochrysen-1-amine.
| Compound Name | (1S,2S)-2-benzyl-1,2,11,12-tetrahydrochrysen-1-amine |
|---|---|
| PubChem CID | 174735552 |
| Molecular Formula | C25H23N |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | (1S,2S)-2-benzyl-1,2,11,12-tetrahydrochrysen-1-amine |
| SMILES | N[C@@H]1C2=C(C=C[C@@H]1Cc1ccccc1)c1ccc3ccccc3c1CC2 |
| InChI | InChI=1S/C25H23N/c26-25-19(16-17-6-2-1-3-7-17)11-13-23-22-12-10-18-8-4-5-9-20(18)21(22)14-15-24(23)25/h1-13,19,25H,14-16,26H2/t19-,25+/m1/s1 |
| InChIKey | VKDZCTAVFZKDFU-CLOONOSVSA-N |
| XLogP | 5.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |