C53H56N6O3 — CID 174735581
1,5-bis[4-[(dimethylamino)methyl]phenyl]-2,4-bis(1H-indol-3-yl)-1,5-bis(2-methoxyanilino)pentan-3-one (PubChem CID 174735581) has the molecular formula C53H56N6O3 and a molecular weight of 825.07 g/mol. Its IUPAC name is 1,5-bis[4-[(dimethylamino)methyl]phenyl]-2,4-bis(1H-indol-3-yl)-1,5-bis(2-methoxyanilino)pentan-3-one.
| Compound Name | 1,5-bis[4-[(dimethylamino)methyl]phenyl]-2,4-bis(1H-indol-3-yl)-1,5-bis(2-methoxyanilino)pentan-3-one |
|---|---|
| PubChem CID | 174735581 |
| Molecular Formula | C53H56N6O3 |
| Molecular Weight | 825.07 g/mol |
| Exact Mass | 824.44 |
| IUPAC Name | 1,5-bis[4-[(dimethylamino)methyl]phenyl]-2,4-bis(1H-indol-3-yl)-1,5-bis(2-methoxyanilino)pentan-3-one |
| SMILES | COc1ccccc1NC(c1ccc(CN(C)C)cc1)C(C(=O)C(c1c[nH]c2ccccc12)C(Nc1ccccc1OC)c1ccc(CN(C)C)cc1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C53H56N6O3/c1-58(2)33-35-23-27-37(28-24-35)51(56-45-19-11-13-21-47(45)61-5)49(41-31-54-43-17-9-7-15-39(41)43)53(60)50(42-32-55-44-18-10-8-16-40(42)44)52(57-46-20-12-14-22-48(46)62-6)38-29-25-36(26-30-38)34-59(3)4/h7-32,49-52,54-57H,33-34H2,1-6H3 |
| InChIKey | LZGFBUCRALDGNS-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.07 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |