C16H18O7 — CID 174735776
propanoyl 3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]benzoate (PubChem CID 174735776) has the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. Its IUPAC name is propanoyl 3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]benzoate.
| Compound Name | propanoyl 3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]benzoate |
|---|---|
| PubChem CID | 174735776 |
| Molecular Formula | C16H18O7 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | propanoyl 3-[(3R,3aR,6R,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl]benzoate |
| SMILES | CCC(=O)OC(=O)c1cccc([C@@]2(O)CO[C@@H]3[C@H](O)CO[C@@H]32)c1 |
| InChI | InChI=1S/C16H18O7/c1-2-12(18)23-15(19)9-4-3-5-10(6-9)16(20)8-22-13-11(17)7-21-14(13)16/h3-6,11,13-14,17,20H,2,7-8H2,1H3/t11-,13-,14+,16+/m1/s1 |
| InChIKey | KPODNRJBKUVFQF-UYHMYPTGSA-N |
| XLogP | 0.13 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|