About sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate
sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate (PubChem CID 174736147) has the molecular formula C20H20N3NaO3S
and a molecular weight of 405.46 g/mol. Its IUPAC name is sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate.
Molecular Properties
| Compound Name | sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
| PubChem CID | 174736147 |
| Molecular Formula | C20H20N3NaO3S |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)Oc3ccccc3)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C20H19N3O3S.Na.H/c1-23(2)18-12-8-16(9-13-18)21-22-17-10-14-20(15-11-17)27(24,25)26-19-6-4-3-5-7-19;;/h3-15H,1-2H3;;/q;+1;-1/b22-21+;; |
| InChIKey | YMQYVESEBFKXKM-ZPZFBZIMSA-N |
| XLogP | 2.05 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate?
The IUPAC name of sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate (CID 174736147) is sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate.
What is the SMILES notation for sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate?
The canonical SMILES for sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate is CN(C)c1ccc(/N=N/c2ccc(S(=O)(=O)Oc3ccccc3)cc2)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate?
The InChIKey is YMQYVESEBFKXKM-ZPZFBZIMSA-N. The full InChI is InChI=1S/C20H19N3O3S.Na.H/c1-23(2)18-12-8-16(9-13-18)21-22-17-10-14-20(15-11-17)27(24,25)26-19-6-4-3-5-7-19;;/h3-15H,1-2H3;;/q;+1;-1/b22-21+;;.
What are the key properties of sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate?
sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate has a molecular weight of 405.46 g/mol, XLogP of 2.05, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phenyl 4-[[4-(dimethylamino)phenyl]diazenyl]benzenesulfonate is sourced from PubChem (CID 174736147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).