About (2-formylphenyl)boronic acid;oxolane
(2-formylphenyl)boronic acid;oxolane (PubChem CID 174736700) has the molecular formula C11H15BO4
and a molecular weight of 222.05 g/mol. Its IUPAC name is (2-formylphenyl)boronic acid;oxolane.
Molecular Properties
| Compound Name | (2-formylphenyl)boronic acid;oxolane |
| PubChem CID | 174736700 |
| Molecular Formula | C11H15BO4 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (2-formylphenyl)boronic acid;oxolane |
| SMILES | C1CCOC1.O=Cc1ccccc1B(O)O |
| InChI | InChI=1S/C7H7BO3.C4H8O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-4-5-3-1/h1-5,10-11H;1-4H2 |
| InChIKey | YKVKDGRINLFSMJ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-formylphenyl)boronic acid;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-formylphenyl)boronic acid;oxolane?
The IUPAC name of (2-formylphenyl)boronic acid;oxolane (CID 174736700) is (2-formylphenyl)boronic acid;oxolane.
What is the SMILES notation for (2-formylphenyl)boronic acid;oxolane?
The canonical SMILES for (2-formylphenyl)boronic acid;oxolane is C1CCOC1.O=Cc1ccccc1B(O)O.
What is the InChIKey of (2-formylphenyl)boronic acid;oxolane?
The InChIKey is YKVKDGRINLFSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BO3.C4H8O/c9-5-6-3-1-2-4-7(6)8(10)11;1-2-4-5-3-1/h1-5,10-11H;1-4H2.
What are the key properties of (2-formylphenyl)boronic acid;oxolane?
(2-formylphenyl)boronic acid;oxolane has a molecular weight of 222.05 g/mol, XLogP of -0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-formylphenyl)boronic acid;oxolane is sourced from PubChem (CID 174736700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).