About 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde
5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde (PubChem CID 174736811) has the molecular formula C10H11FN2O
and a molecular weight of 194.21 g/mol. Its IUPAC name is 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde |
| PubChem CID | 174736811 |
| Molecular Formula | C10H11FN2O |
| Molecular Weight | 194.21 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde |
| SMILES | C=CCC(C=CF)c1[nH]ncc1C=O |
| InChI | InChI=1S/C10H11FN2O/c1-2-3-8(4-5-11)10-9(7-14)6-12-13-10/h2,4-8H,1,3H2,(H,12,13) |
| InChIKey | NGLNZBNAZPPOJO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde?
The IUPAC name of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde (CID 174736811) is 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde.
What is the SMILES notation for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde?
The canonical SMILES for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde is C=CCC(C=CF)c1[nH]ncc1C=O.
What is the InChIKey of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde?
The InChIKey is NGLNZBNAZPPOJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O/c1-2-3-8(4-5-11)10-9(7-14)6-12-13-10/h2,4-8H,1,3H2,(H,12,13).
What are the key properties of 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde?
5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde has a molecular weight of 194.21 g/mol, XLogP of 2.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-fluorohexa-1,5-dien-3-yl)-1H-pyrazole-4-carbaldehyde is sourced from PubChem (CID 174736811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).