About 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate
6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate (PubChem CID 174736866) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate.
Molecular Properties
| Compound Name | 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate |
| PubChem CID | 174736866 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate |
| SMILES | C=CCC=C(O)C(N)(CC=C)CC=C.O |
| InChI | InChI=1S/C12H19NO.H2O/c1-4-7-8-11(14)12(13,9-5-2)10-6-3;/h4-6,8,14H,1-3,7,9-10,13H2;1H2 |
| InChIKey | XEPQYLPMUWCRMY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate?
The IUPAC name of 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate (CID 174736866) is 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate.
What is the SMILES notation for 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate?
The canonical SMILES for 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate is C=CCC=C(O)C(N)(CC=C)CC=C.O.
What is the InChIKey of 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate?
The InChIKey is XEPQYLPMUWCRMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO.H2O/c1-4-7-8-11(14)12(13,9-5-2)10-6-3;/h4-6,8,14H,1-3,7,9-10,13H2;1H2.
What are the key properties of 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate?
6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate has a molecular weight of 211.30 g/mol, XLogP of 2.03, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-6-prop-2-enylnona-1,4,8-trien-5-ol;hydrate is sourced from PubChem (CID 174736866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).