About sodium;2,3-dichloroprop-1-ene;thiocyanate
sodium;2,3-dichloroprop-1-ene;thiocyanate (PubChem CID 174736995) has the molecular formula C4H4Cl2NNaS
and a molecular weight of 192.05 g/mol. Its IUPAC name is sodium;2,3-dichloroprop-1-ene;thiocyanate.
Molecular Properties
| Compound Name | sodium;2,3-dichloroprop-1-ene;thiocyanate |
| PubChem CID | 174736995 |
| Molecular Formula | C4H4Cl2NNaS |
| Molecular Weight | 192.05 g/mol |
| Exact Mass | 190.93 |
| IUPAC Name | sodium;2,3-dichloroprop-1-ene;thiocyanate |
| SMILES | C=C(Cl)CCl.N#C[S-].[Na+] |
| InChI | InChI=1S/C3H4Cl2.CHNS.Na/c1-3(5)2-4;2-1-3;/h1-2H2;3H;/q;;+1/p-1 |
| InChIKey | NWNMAOONIGRWMK-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.05 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2,3-dichloroprop-1-ene;thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2,3-dichloroprop-1-ene;thiocyanate?
The IUPAC name of sodium;2,3-dichloroprop-1-ene;thiocyanate (CID 174736995) is sodium;2,3-dichloroprop-1-ene;thiocyanate.
What is the SMILES notation for sodium;2,3-dichloroprop-1-ene;thiocyanate?
The canonical SMILES for sodium;2,3-dichloroprop-1-ene;thiocyanate is C=C(Cl)CCl.N#C[S-].[Na+].
What is the InChIKey of sodium;2,3-dichloroprop-1-ene;thiocyanate?
The InChIKey is NWNMAOONIGRWMK-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4Cl2.CHNS.Na/c1-3(5)2-4;2-1-3;/h1-2H2;3H;/q;;+1/p-1.
What are the key properties of sodium;2,3-dichloroprop-1-ene;thiocyanate?
sodium;2,3-dichloroprop-1-ene;thiocyanate has a molecular weight of 192.05 g/mol, XLogP of -1.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2,3-dichloroprop-1-ene;thiocyanate is sourced from PubChem (CID 174736995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).